C14H23ClN2S — CID 78823684
N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(1-methylpiperidin-2-yl)ethanamine (PubChem CID 78823684) has the molecular formula C14H23ClN2S and a molecular weight of 286.87 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(1-methylpiperidin-2-yl)ethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(1-methylpiperidin-2-yl)ethanamine |
|---|---|
| PubChem CID | 78823684 |
| Molecular Formula | C14H23ClN2S |
| Molecular Weight | 286.87 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-(1-methylpiperidin-2-yl)ethanamine |
| SMILES | CN(CCC1CCCCN1C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H23ClN2S/c1-16(11-13-6-7-14(15)18-13)10-8-12-5-3-4-9-17(12)2/h6-7,12H,3-5,8-11H2,1-2H3 |
| InChIKey | MRCZNCDFTULCNZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |