C17H14FNO3S — CID 78823758
4-fluoro-N-(3-hydroxyphenyl)-3-(methoxymethyl)-1-benzothiophene-2-carboxamide (PubChem CID 78823758) has the molecular formula C17H14FNO3S and a molecular weight of 331.37 g/mol. Its IUPAC name is 4-fluoro-N-(3-hydroxyphenyl)-3-(methoxymethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-(3-hydroxyphenyl)-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 78823758 |
| Molecular Formula | C17H14FNO3S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 4-fluoro-N-(3-hydroxyphenyl)-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCc1c(C(=O)Nc2cccc(O)c2)sc2cccc(F)c12 |
| InChI | InChI=1S/C17H14FNO3S/c1-22-9-12-15-13(18)6-3-7-14(15)23-16(12)17(21)19-10-4-2-5-11(20)8-10/h2-8,20H,9H2,1H3,(H,19,21) |
| InChIKey | AXMAPQDVWOLCPQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |