About N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine
N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine (PubChem CID 78823897) has the molecular formula C11H21NO2S
and a molecular weight of 231.36 g/mol. Its IUPAC name is N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine.
Molecular Properties
| Compound Name | N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine |
| PubChem CID | 78823897 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine |
| SMILES | C=CCN(CC(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21NO2S/c1-4-6-12(8-10(2)3)11-5-7-15(13,14)9-11/h4,10-11H,1,5-9H2,2-3H3 |
| InChIKey | CDKYDNINRPOYHZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine?
The IUPAC name of N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine (CID 78823897) is N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine.
What is the SMILES notation for N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine?
The canonical SMILES for N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine is C=CCN(CC(C)C)C1CCS(=O)(=O)C1.
What is the InChIKey of N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine?
The InChIKey is CDKYDNINRPOYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2S/c1-4-6-12(8-10(2)3)11-5-7-15(13,14)9-11/h4,10-11H,1,5-9H2,2-3H3.
What are the key properties of N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine?
N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine has a molecular weight of 231.36 g/mol, XLogP of 1.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)-1,1-dioxo-N-prop-2-enylthiolan-3-amine is sourced from PubChem (CID 78823897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).