C21H21F2N3O3 — CID 78823959
2-[4-[4-(difluoromethoxy)benzoyl]piperazin-1-yl]-2-(4-methoxyphenyl)acetonitrile (PubChem CID 78823959) has the molecular formula C21H21F2N3O3 and a molecular weight of 401.41 g/mol. Its IUPAC name is 2-[4-[4-(difluoromethoxy)benzoyl]piperazin-1-yl]-2-(4-methoxyphenyl)acetonitrile.
| Compound Name | 2-[4-[4-(difluoromethoxy)benzoyl]piperazin-1-yl]-2-(4-methoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 78823959 |
| Molecular Formula | C21H21F2N3O3 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-[4-[4-(difluoromethoxy)benzoyl]piperazin-1-yl]-2-(4-methoxyphenyl)acetonitrile |
| SMILES | COc1ccc(C(C#N)N2CCN(C(=O)c3ccc(OC(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H21F2N3O3/c1-28-17-6-2-15(3-7-17)19(14-24)25-10-12-26(13-11-25)20(27)16-4-8-18(9-5-16)29-21(22)23/h2-9,19,21H,10-13H2,1H3 |
| InChIKey | CWCFVFVLAQNTRJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |