C18H16INO3 — CID 78824654
methyl 2-(2-iodobenzoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 78824654) has the molecular formula C18H16INO3 and a molecular weight of 421.23 g/mol. Its IUPAC name is methyl 2-(2-iodobenzoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(2-iodobenzoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 78824654 |
| Molecular Formula | C18H16INO3 |
| Molecular Weight | 421.23 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | methyl 2-(2-iodobenzoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | COC(=O)C1Cc2ccccc2CN1C(=O)c1ccccc1I |
| InChI | InChI=1S/C18H16INO3/c1-23-18(22)16-10-12-6-2-3-7-13(12)11-20(16)17(21)14-8-4-5-9-15(14)19/h2-9,16H,10-11H2,1H3 |
| InChIKey | DVZQQJTVDAZBCQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|