C20H28N4O4S — CID 78825367
N,N-diethyl-3-[(2-nitrophenyl)methylamino]-4-(propylamino)benzenesulfonamide (PubChem CID 78825367) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is N,N-diethyl-3-[(2-nitrophenyl)methylamino]-4-(propylamino)benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[(2-nitrophenyl)methylamino]-4-(propylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 78825367 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N,N-diethyl-3-[(2-nitrophenyl)methylamino]-4-(propylamino)benzenesulfonamide |
| SMILES | CCCNc1ccc(S(=O)(=O)N(CC)CC)cc1NCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H28N4O4S/c1-4-13-21-18-12-11-17(29(27,28)23(5-2)6-3)14-19(18)22-15-16-9-7-8-10-20(16)24(25)26/h7-12,14,21-22H,4-6,13,15H2,1-3H3 |
| InChIKey | QBBPQCQPKMPXPS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|