C19H31NO3 — CID 78827409
1-[2-(4-methoxyphenyl)azepan-1-yl]-3-propan-2-yloxypropan-2-ol (PubChem CID 78827409) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)azepan-1-yl]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[2-(4-methoxyphenyl)azepan-1-yl]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 78827409 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)azepan-1-yl]-3-propan-2-yloxypropan-2-ol |
| SMILES | COc1ccc(C2CCCCCN2CC(O)COC(C)C)cc1 |
| InChI | InChI=1S/C19H31NO3/c1-15(2)23-14-17(21)13-20-12-6-4-5-7-19(20)16-8-10-18(22-3)11-9-16/h8-11,15,17,19,21H,4-7,12-14H2,1-3H3 |
| InChIKey | MTLKCQJTOBFGAT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |