C18H28N2O4 — CID 78827478
5-(methoxymethyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]furan-2-carboxamide (PubChem CID 78827478) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]furan-2-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78827478 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 5-(methoxymethyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)NCC2(N3CCOCC3)CCCCC2)o1 |
| InChI | InChI=1S/C18H28N2O4/c1-22-13-15-5-6-16(24-15)17(21)19-14-18(7-3-2-4-8-18)20-9-11-23-12-10-20/h5-6H,2-4,7-14H2,1H3,(H,19,21) |
| InChIKey | SBLNKOQWZHWHAT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |