About 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide
2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide (PubChem CID 78828059) has the molecular formula C8H7Cl2N3O2S
and a molecular weight of 280.14 g/mol. Its IUPAC name is 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide |
| PubChem CID | 78828059 |
| Molecular Formula | C8H7Cl2N3O2S |
| Molecular Weight | 280.14 g/mol |
| Exact Mass | 278.96 |
| IUPAC Name | 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1cnc(NC(=O)C2CC2(Cl)Cl)s1 |
| InChI | InChI=1S/C8H7Cl2N3O2S/c9-8(10)1-3(8)6(15)13-7-12-2-4(16-7)5(11)14/h2-3H,1H2,(H2,11,14)(H,12,13,15) |
| InChIKey | GXWOCHYILYUYBC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.14 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide (CID 78828059) is 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide is NC(=O)c1cnc(NC(=O)C2CC2(Cl)Cl)s1.
What is the InChIKey of 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide?
The InChIKey is GXWOCHYILYUYBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2N3O2S/c9-8(10)1-3(8)6(15)13-7-12-2-4(16-7)5(11)14/h2-3H,1H2,(H2,11,14)(H,12,13,15).
What are the key properties of 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide?
2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide has a molecular weight of 280.14 g/mol, XLogP of 1.37, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dichlorocyclopropanecarbonyl)amino]-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 78828059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).