About 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one
2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one (PubChem CID 788283) has the molecular formula C19H25NO2
and a molecular weight of 299.41 g/mol. Its IUPAC name is 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one |
| PubChem CID | 788283 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one |
| SMILES | CCCC(=O)C1=C(N(C)c2ccccc2)CC(C)(C)CC1=O |
| InChI | InChI=1S/C19H25NO2/c1-5-9-16(21)18-15(12-19(2,3)13-17(18)22)20(4)14-10-7-6-8-11-14/h6-8,10-11H,5,9,12-13H2,1-4H3 |
| InChIKey | OAWORAZSMAEIBE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one?
The IUPAC name of 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one (CID 788283) is 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one.
What is the SMILES notation for 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one?
The canonical SMILES for 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one is CCCC(=O)C1=C(N(C)c2ccccc2)CC(C)(C)CC1=O.
What is the InChIKey of 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one?
The InChIKey is OAWORAZSMAEIBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO2/c1-5-9-16(21)18-15(12-19(2,3)13-17(18)22)20(4)14-10-7-6-8-11-14/h6-8,10-11H,5,9,12-13H2,1-4H3.
What are the key properties of 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one?
2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one has a molecular weight of 299.41 g/mol, XLogP of 4.14, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butanoyl-5,5-dimethyl-3-(N-methylanilino)cyclohex-2-en-1-one is sourced from PubChem (CID 788283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).