C16H19ClF2N4 — CID 78828337
1-(5-chloro-2-methylphenyl)-4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazine (PubChem CID 78828337) has the molecular formula C16H19ClF2N4 and a molecular weight of 340.81 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazine.
| Compound Name | 1-(5-chloro-2-methylphenyl)-4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazine |
|---|---|
| PubChem CID | 78828337 |
| Molecular Formula | C16H19ClF2N4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazine |
| SMILES | Cc1ccc(Cl)cc1N1CCN(Cc2nccn2C(F)F)CC1 |
| InChI | InChI=1S/C16H19ClF2N4/c1-12-2-3-13(17)10-14(12)22-8-6-21(7-9-22)11-15-20-4-5-23(15)16(18)19/h2-5,10,16H,6-9,11H2,1H3 |
| InChIKey | ATEVFVHTAZFRBC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |