About N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide
N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 78828621) has the molecular formula C20H25N3O4S
and a molecular weight of 403.50 g/mol. Its IUPAC name is N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide.
Molecular Properties
| Compound Name | N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide |
| PubChem CID | 78828621 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)C2(C(=O)NNC(=O)c3cccn3C)CCCC2)c1 |
| InChI | InChI=1S/C20H25N3O4S/c1-14-8-9-15(2)17(13-14)28(26,27)20(10-4-5-11-20)19(25)22-21-18(24)16-7-6-12-23(16)3/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | GNXYKYLPADMQRD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide?
The IUPAC name of N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide (CID 78828621) is N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide.
What is the SMILES notation for N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide?
The canonical SMILES for N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide is Cc1ccc(C)c(S(=O)(=O)C2(C(=O)NNC(=O)c3cccn3C)CCCC2)c1.
What is the InChIKey of N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide?
The InChIKey is GNXYKYLPADMQRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O4S/c1-14-8-9-15(2)17(13-14)28(26,27)20(10-4-5-11-20)19(25)22-21-18(24)16-7-6-12-23(16)3/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,21,24)(H,22,25).
What are the key properties of N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide?
N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide has a molecular weight of 403.50 g/mol, XLogP of 2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]-1-methylpyrrole-2-carbohydrazide is sourced from PubChem (CID 78828621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).