C21H23N5O2 — CID 78829253
N-(2-acetylphenyl)-2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]propanamide (PubChem CID 78829253) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]propanamide.
| Compound Name | N-(2-acetylphenyl)-2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 78829253 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-(2-acetylphenyl)-2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]propanamide |
| SMILES | CC(=O)c1ccccc1NC(=O)C(C)N1CCN(c2ncccc2C#N)CC1 |
| InChI | InChI=1S/C21H23N5O2/c1-15(21(28)24-19-8-4-3-7-18(19)16(2)27)25-10-12-26(13-11-25)20-17(14-22)6-5-9-23-20/h3-9,15H,10-13H2,1-2H3,(H,24,28) |
| InChIKey | BOCHMEGLCMLZOY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |