C14H11Br2FN2O2 — CID 78830186
N-(4-bromo-2-fluorophenyl)-3-(5-bromo-2-oxo-1-pyridinyl)propanamide (PubChem CID 78830186) has the molecular formula C14H11Br2FN2O2 and a molecular weight of 418.06 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-3-(5-bromo-2-oxo-1-pyridinyl)propanamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-3-(5-bromo-2-oxo-1-pyridinyl)propanamide |
|---|---|
| PubChem CID | 78830186 |
| Molecular Formula | C14H11Br2FN2O2 |
| Molecular Weight | 418.06 g/mol |
| Exact Mass | 415.92 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-3-(5-bromo-2-oxo-1-pyridinyl)propanamide |
| SMILES | O=C(CCn1cc(Br)ccc1=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C14H11Br2FN2O2/c15-9-1-3-12(11(17)7-9)18-13(20)5-6-19-8-10(16)2-4-14(19)21/h1-4,7-8H,5-6H2,(H,18,20) |
| InChIKey | RVHYBVYEXHPLMP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.06 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |