C16H19N3OS — CID 78831190
2-[(3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-prop-2-enylpropanamide (PubChem CID 78831190) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-[(3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-prop-2-enylpropanamide.
| Compound Name | 2-[(3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 78831190 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-[(3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Sc1nc2c(cc1C#N)CCCC2 |
| InChI | InChI=1S/C16H19N3OS/c1-3-8-18-15(20)11(2)21-16-13(10-17)9-12-6-4-5-7-14(12)19-16/h3,9,11H,1,4-8H2,2H3,(H,18,20) |
| InChIKey | FPSQLPIOTHCAHR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|