C18H26FNO3 — CID 78831870
[4-(2-methylpropyl)morpholin-2-yl]methyl 3-(3-fluorophenyl)propanoate (PubChem CID 78831870) has the molecular formula C18H26FNO3 and a molecular weight of 323.41 g/mol. Its IUPAC name is [4-(2-methylpropyl)morpholin-2-yl]methyl 3-(3-fluorophenyl)propanoate.
| Compound Name | [4-(2-methylpropyl)morpholin-2-yl]methyl 3-(3-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 78831870 |
| Molecular Formula | C18H26FNO3 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | [4-(2-methylpropyl)morpholin-2-yl]methyl 3-(3-fluorophenyl)propanoate |
| SMILES | CC(C)CN1CCOC(COC(=O)CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C18H26FNO3/c1-14(2)11-20-8-9-22-17(12-20)13-23-18(21)7-6-15-4-3-5-16(19)10-15/h3-5,10,14,17H,6-9,11-13H2,1-2H3 |
| InChIKey | JTNHGEZGBHHVJS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |