C19H18N6O2S — CID 78832578
1-propan-2-yl-N'-(1H-pyrrole-2-carbonyl)-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 78832578) has the molecular formula C19H18N6O2S and a molecular weight of 394.46 g/mol. Its IUPAC name is 1-propan-2-yl-N'-(1H-pyrrole-2-carbonyl)-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | 1-propan-2-yl-N'-(1H-pyrrole-2-carbonyl)-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 78832578 |
| Molecular Formula | C19H18N6O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-propan-2-yl-N'-(1H-pyrrole-2-carbonyl)-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | CC(C)n1ncc2c(C(=O)NNC(=O)c3ccc[nH]3)cc(-c3cccs3)nc21 |
| InChI | InChI=1S/C19H18N6O2S/c1-11(2)25-17-13(10-21-25)12(9-15(22-17)16-6-4-8-28-16)18(26)23-24-19(27)14-5-3-7-20-14/h3-11,20H,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | YLHDSNAPDTYQSA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|