C21H15N3O4S — CID 78833790
2,3-dihydro-1,4-benzodioxin-6-yl 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate (PubChem CID 78833790) has the molecular formula C21H15N3O4S and a molecular weight of 405.44 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 78833790 |
| Molecular Formula | C21H15N3O4S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)OCCO2)c1nc(-c2cccs2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H15N3O4S/c25-21(28-15-8-9-16-17(13-15)27-11-10-26-16)19-22-20(18-7-4-12-29-18)24(23-19)14-5-2-1-3-6-14/h1-9,12-13H,10-11H2 |
| InChIKey | QATIBKINEFLQEO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|