C20H31N3O3S — CID 78833850
N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]azocane-1-carboxamide (PubChem CID 78833850) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]azocane-1-carboxamide.
| Compound Name | N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]azocane-1-carboxamide |
|---|---|
| PubChem CID | 78833850 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]azocane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(NC(=O)N3CCCCCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H31N3O3S/c1-17-7-9-19(10-8-17)27(25,26)23-15-11-18(12-16-23)21-20(24)22-13-5-3-2-4-6-14-22/h7-10,18H,2-6,11-16H2,1H3,(H,21,24) |
| InChIKey | WSALKHKIKDPQLK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |