C16H22N4O — CID 78834613
1-tert-butyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)urea (PubChem CID 78834613) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-tert-butyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)urea.
| Compound Name | 1-tert-butyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 78834613 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1-tert-butyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)urea |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H22N4O/c1-11-14(17-15(21)18-16(3,4)5)12(2)20(19-11)13-9-7-6-8-10-13/h6-10H,1-5H3,(H2,17,18,21) |
| InChIKey | UGRGYGHNTPOYIC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |