C19H19N3OS — CID 78835980
2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-phenylacetamide (PubChem CID 78835980) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-phenylacetamide.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 78835980 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-phenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)N1CCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H19N3OS/c20-18(23)17(13-7-2-1-3-8-13)22-12-6-10-15(22)19-21-14-9-4-5-11-16(14)24-19/h1-5,7-9,11,15,17H,6,10,12H2,(H2,20,23) |
| InChIKey | UGXMGZVUTYDERE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |