C14H22N2O2 — CID 78836443
2-ethoxy-N,N-dipropylpyridine-3-carboxamide (PubChem CID 78836443) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-ethoxy-N,N-dipropylpyridine-3-carboxamide.
| Compound Name | 2-ethoxy-N,N-dipropylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 78836443 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-ethoxy-N,N-dipropylpyridine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccnc1OCC |
| InChI | InChI=1S/C14H22N2O2/c1-4-10-16(11-5-2)14(17)12-8-7-9-15-13(12)18-6-3/h7-9H,4-6,10-11H2,1-3H3 |
| InChIKey | ZBZVJALWDVOHPK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |