C18H15NO6 — CID 7883743
phenacyl 2-(1,3-benzodioxole-5-carbonylamino)acetate (PubChem CID 7883743) has the molecular formula C18H15NO6 and a molecular weight of 341.32 g/mol. Its IUPAC name is phenacyl 2-(1,3-benzodioxole-5-carbonylamino)acetate.
| Compound Name | phenacyl 2-(1,3-benzodioxole-5-carbonylamino)acetate |
|---|---|
| PubChem CID | 7883743 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | phenacyl 2-(1,3-benzodioxole-5-carbonylamino)acetate |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCO2)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15NO6/c20-14(12-4-2-1-3-5-12)10-23-17(21)9-19-18(22)13-6-7-15-16(8-13)25-11-24-15/h1-8H,9-11H2,(H,19,22) |
| InChIKey | QVIWVVQVASXKQQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |