About 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide
6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide (PubChem CID 78837599) has the molecular formula C14H14ClN3O
and a molecular weight of 275.74 g/mol. Its IUPAC name is 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide |
| PubChem CID | 78837599 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc(Cl)nc2)c(C)n1 |
| InChI | InChI=1S/C14H14ClN3O/c1-8-6-9(2)17-10(3)13(8)18-14(19)11-4-5-12(15)16-7-11/h4-7H,1-3H3,(H,18,19) |
| InChIKey | RKVOLWWFTZKVAC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide?
The IUPAC name of 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide (CID 78837599) is 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide.
What is the SMILES notation for 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide?
The canonical SMILES for 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide is Cc1cc(C)c(NC(=O)c2ccc(Cl)nc2)c(C)n1.
What is the InChIKey of 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide?
The InChIKey is RKVOLWWFTZKVAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClN3O/c1-8-6-9(2)17-10(3)13(8)18-14(19)11-4-5-12(15)16-7-11/h4-7H,1-3H3,(H,18,19).
What are the key properties of 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide?
6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide has a molecular weight of 275.74 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(2,4,6-trimethyl-3-pyridinyl)pyridine-3-carboxamide is sourced from PubChem (CID 78837599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).