C20H33NO3 — CID 78839356
1-[[1-(4-ethylphenyl)-2-methylpropyl]amino]-3-(oxolan-2-ylmethoxy)propan-2-ol (PubChem CID 78839356) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-[[1-(4-ethylphenyl)-2-methylpropyl]amino]-3-(oxolan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[[1-(4-ethylphenyl)-2-methylpropyl]amino]-3-(oxolan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 78839356 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 1-[[1-(4-ethylphenyl)-2-methylpropyl]amino]-3-(oxolan-2-ylmethoxy)propan-2-ol |
| SMILES | CCc1ccc(C(NCC(O)COCC2CCCO2)C(C)C)cc1 |
| InChI | InChI=1S/C20H33NO3/c1-4-16-7-9-17(10-8-16)20(15(2)3)21-12-18(22)13-23-14-19-6-5-11-24-19/h7-10,15,18-22H,4-6,11-14H2,1-3H3 |
| InChIKey | DURGNLJGSKQSMT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |