C19H18N2O4 — CID 78839801
3-pyridin-3-ylpropyl 5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxylate (PubChem CID 78839801) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxylate.
| Compound Name | 3-pyridin-3-ylpropyl 5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 78839801 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3-pyridin-3-ylpropyl 5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxylate |
| SMILES | O=C(OCCCc1cccnc1)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C19H18N2O4/c22-18-7-1-2-11-21(18)14-16-8-9-17(25-16)19(23)24-12-4-6-15-5-3-10-20-13-15/h1-3,5,7-11,13H,4,6,12,14H2 |
| InChIKey | PCHQCBXKRYODPB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|