C14H22O4S — CID 788405
trans-ethyl (1S,2S)-2-[(2R)-2-ethylsulfanylpropyl]-4,6-dioxocyclohexane-1-carboxylate (PubChem CID 788405) has the molecular formula C14H22O4S and a molecular weight of 286.39 g/mol. Its IUPAC name is trans-ethyl (1S,2S)-2-[(2R)-2-ethylsulfanylpropyl]-4,6-dioxocyclohexane-1-carboxylate.
| Compound Name | trans-ethyl (1S,2S)-2-[(2R)-2-ethylsulfanylpropyl]-4,6-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 788405 |
| Molecular Formula | C14H22O4S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | trans-ethyl (1S,2S)-2-[(2R)-2-ethylsulfanylpropyl]-4,6-dioxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)CC(=O)C[C@H]1C[C@@H](C)SCC |
| InChI | InChI=1S/C14H22O4S/c1-4-18-14(17)13-10(6-9(3)19-5-2)7-11(15)8-12(13)16/h9-10,13H,4-8H2,1-3H3/t9-,10-,13+/m1/s1 |
| InChIKey | WYLFSJUSABJKTE-BREBYQMCSA-N |
| XLogP | 2.25 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|