C26H34N2O4 — CID 78840852
N-[[4-(dimethylamino)phenyl]methyl]-3-(oxolan-2-ylmethoxy)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 78840852) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-3-(oxolan-2-ylmethoxy)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-3-(oxolan-2-ylmethoxy)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 78840852 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-3-(oxolan-2-ylmethoxy)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CN(C)c1ccc(CN(CC2CCCO2)C(=O)c2cccc(OCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C26H34N2O4/c1-27(2)22-12-10-20(11-13-22)17-28(18-24-8-4-14-30-24)26(29)21-6-3-7-23(16-21)32-19-25-9-5-15-31-25/h3,6-7,10-13,16,24-25H,4-5,8-9,14-15,17-19H2,1-2H3 |
| InChIKey | SVNZSIYVYQZGIE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|