About cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate
cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate (PubChem CID 78842086) has the molecular formula C13H22O2S
and a molecular weight of 242.38 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate.
Molecular Properties
| Compound Name | cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate |
| PubChem CID | 78842086 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate |
| SMILES | CC(C)(C)SCC(=O)OCC1CC=CCC1 |
| InChI | InChI=1S/C13H22O2S/c1-13(2,3)16-10-12(14)15-9-11-7-5-4-6-8-11/h4-5,11H,6-10H2,1-3H3 |
| InChIKey | ADPVTZBWPNUXLO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate?
The IUPAC name of cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate (CID 78842086) is cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate.
What is the SMILES notation for cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate?
The canonical SMILES for cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate is CC(C)(C)SCC(=O)OCC1CC=CCC1.
What is the InChIKey of cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate?
The InChIKey is ADPVTZBWPNUXLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2S/c1-13(2,3)16-10-12(14)15-9-11-7-5-4-6-8-11/h4-5,11H,6-10H2,1-3H3.
What are the key properties of cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate?
cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate has a molecular weight of 242.38 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-3-en-1-ylmethyl 2-tert-butylsulfanylacetate is sourced from PubChem (CID 78842086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).