C21H25NO3S — CID 78842695
methyl 2-[2-(3,3-diphenylpropylamino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 78842695) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is methyl 2-[2-(3,3-diphenylpropylamino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 2-[2-(3,3-diphenylpropylamino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 78842695 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | methyl 2-[2-(3,3-diphenylpropylamino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | COC(=O)C(C)SCC(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3S/c1-16(21(24)25-2)26-15-20(23)22-14-13-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19H,13-15H2,1-2H3,(H,22,23) |
| InChIKey | FJTPFSYPUIXSAZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |