C12H13Cl2NO3S — CID 78842724
methyl 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 78842724) has the molecular formula C12H13Cl2NO3S and a molecular weight of 322.21 g/mol. Its IUPAC name is methyl 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 78842724 |
| Molecular Formula | C12H13Cl2NO3S |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | methyl 2-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | COC(=O)C(C)SCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2NO3S/c1-7(12(17)18-2)19-6-11(16)15-10-4-3-8(13)5-9(10)14/h3-5,7H,6H2,1-2H3,(H,15,16) |
| InChIKey | WNUHDHVWGJINLO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |