C12H19N3 — CID 78845238
4,6-dimethyl-2-(4-methylpiperidin-1-yl)pyrimidine (PubChem CID 78845238) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 4,6-dimethyl-2-(4-methylpiperidin-1-yl)pyrimidine.
| Compound Name | 4,6-dimethyl-2-(4-methylpiperidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 78845238 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 4,6-dimethyl-2-(4-methylpiperidin-1-yl)pyrimidine |
| SMILES | Cc1cc(C)nc(N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C12H19N3/c1-9-4-6-15(7-5-9)12-13-10(2)8-11(3)14-12/h8-9H,4-7H2,1-3H3 |
| InChIKey | SENUTJSKSHAULG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |