C14H16ClN3 — CID 78845412
N-[2-(3-chlorophenyl)ethyl]-4,6-dimethylpyrimidin-2-amine (PubChem CID 78845412) has the molecular formula C14H16ClN3 and a molecular weight of 261.76 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 78845412 |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NCCc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H16ClN3/c1-10-8-11(2)18-14(17-10)16-7-6-12-4-3-5-13(15)9-12/h3-5,8-9H,6-7H2,1-2H3,(H,16,17,18) |
| InChIKey | SOHJIGFMSLSMNX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |