About ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate
ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate (PubChem CID 78846406) has the molecular formula C11H18N2O3S
and a molecular weight of 258.34 g/mol. Its IUPAC name is ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate |
| PubChem CID | 78846406 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate |
| SMILES | CCCCc1noc(CSCC(=O)OCC)n1 |
| InChI | InChI=1S/C11H18N2O3S/c1-3-5-6-9-12-10(16-13-9)7-17-8-11(14)15-4-2/h3-8H2,1-2H3 |
| InChIKey | QLTIJFLSEIDMBF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate?
The IUPAC name of ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate (CID 78846406) is ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate.
What is the SMILES notation for ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate?
The canonical SMILES for ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate is CCCCc1noc(CSCC(=O)OCC)n1.
What is the InChIKey of ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate?
The InChIKey is QLTIJFLSEIDMBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3S/c1-3-5-6-9-12-10(16-13-9)7-17-8-11(14)15-4-2/h3-8H2,1-2H3.
What are the key properties of ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate?
ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate has a molecular weight of 258.34 g/mol, XLogP of 2.21, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]acetate is sourced from PubChem (CID 78846406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).