C14H18N2OS — CID 78846456
5-(benzylsulfanylmethyl)-3-butyl-1,2,4-oxadiazole (PubChem CID 78846456) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 5-(benzylsulfanylmethyl)-3-butyl-1,2,4-oxadiazole.
| Compound Name | 5-(benzylsulfanylmethyl)-3-butyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 78846456 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 5-(benzylsulfanylmethyl)-3-butyl-1,2,4-oxadiazole |
| SMILES | CCCCc1noc(CSCc2ccccc2)n1 |
| InChI | InChI=1S/C14H18N2OS/c1-2-3-9-13-15-14(17-16-13)11-18-10-12-7-5-4-6-8-12/h4-8H,2-3,9-11H2,1H3 |
| InChIKey | XOLVQWXKUQWHQF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |