C12H8ClF2NS — CID 78846715
3-chloro-2-[(3,4-difluorophenyl)methylsulfanyl]pyridine (PubChem CID 78846715) has the molecular formula C12H8ClF2NS and a molecular weight of 271.72 g/mol. Its IUPAC name is 3-chloro-2-[(3,4-difluorophenyl)methylsulfanyl]pyridine.
| Compound Name | 3-chloro-2-[(3,4-difluorophenyl)methylsulfanyl]pyridine |
|---|---|
| PubChem CID | 78846715 |
| Molecular Formula | C12H8ClF2NS |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 3-chloro-2-[(3,4-difluorophenyl)methylsulfanyl]pyridine |
| SMILES | Fc1ccc(CSc2ncccc2Cl)cc1F |
| InChI | InChI=1S/C12H8ClF2NS/c13-9-2-1-5-16-12(9)17-7-8-3-4-10(14)11(15)6-8/h1-6H,7H2 |
| InChIKey | LSPMGXLRVPZJHP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |