About 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile
4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile (PubChem CID 78847139) has the molecular formula C18H16FN5S
and a molecular weight of 353.43 g/mol. Its IUPAC name is 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile |
| PubChem CID | 78847139 |
| Molecular Formula | C18H16FN5S |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(F)c(CN2CCN(c3ncnc4sccc34)CC2)c1 |
| InChI | InChI=1S/C18H16FN5S/c19-16-2-1-13(10-20)9-14(16)11-23-4-6-24(7-5-23)17-15-3-8-25-18(15)22-12-21-17/h1-3,8-9,12H,4-7,11H2 |
| InChIKey | RWJQUMVNIJUVRS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile?
The IUPAC name of 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile (CID 78847139) is 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile.
What is the SMILES notation for 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile?
The canonical SMILES for 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile is N#Cc1ccc(F)c(CN2CCN(c3ncnc4sccc34)CC2)c1.
What is the InChIKey of 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile?
The InChIKey is RWJQUMVNIJUVRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN5S/c19-16-2-1-13(10-20)9-14(16)11-23-4-6-24(7-5-23)17-15-3-8-25-18(15)22-12-21-17/h1-3,8-9,12H,4-7,11H2.
What are the key properties of 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile?
4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile has a molecular weight of 353.43 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]benzonitrile is sourced from PubChem (CID 78847139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).