C19H22FNO2 — CID 78847364
N-ethyl-4-(4-fluorophenoxy)-N-(2-methylphenyl)butanamide (PubChem CID 78847364) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is N-ethyl-4-(4-fluorophenoxy)-N-(2-methylphenyl)butanamide.
| Compound Name | N-ethyl-4-(4-fluorophenoxy)-N-(2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 78847364 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-ethyl-4-(4-fluorophenoxy)-N-(2-methylphenyl)butanamide |
| SMILES | CCN(C(=O)CCCOc1ccc(F)cc1)c1ccccc1C |
| InChI | InChI=1S/C19H22FNO2/c1-3-21(18-8-5-4-7-15(18)2)19(22)9-6-14-23-17-12-10-16(20)11-13-17/h4-5,7-8,10-13H,3,6,9,14H2,1-2H3 |
| InChIKey | RWSPBVQICGXDJC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|