About (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate
(5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate (PubChem CID 78847508) has the molecular formula C21H17FN2O4
and a molecular weight of 380.38 g/mol. Its IUPAC name is (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate.
Molecular Properties
| Compound Name | (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate |
| PubChem CID | 78847508 |
| Molecular Formula | C21H17FN2O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate |
| SMILES | O=C1CCC(COC(=O)c2ccccc2-c2ncc(-c3ccccc3F)o2)N1 |
| InChI | InChI=1S/C21H17FN2O4/c22-17-8-4-3-7-16(17)18-11-23-20(28-18)14-5-1-2-6-15(14)21(26)27-12-13-9-10-19(25)24-13/h1-8,11,13H,9-10,12H2,(H,24,25) |
| InChIKey | YUMUHWRFRKVMHJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate?
The IUPAC name of (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate (CID 78847508) is (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate.
What is the SMILES notation for (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate?
The canonical SMILES for (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate is O=C1CCC(COC(=O)c2ccccc2-c2ncc(-c3ccccc3F)o2)N1.
What is the InChIKey of (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate?
The InChIKey is YUMUHWRFRKVMHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17FN2O4/c22-17-8-4-3-7-16(17)18-11-23-20(28-18)14-5-1-2-6-15(14)21(26)27-12-13-9-10-19(25)24-13/h1-8,11,13H,9-10,12H2,(H,24,25).
What are the key properties of (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate?
(5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate has a molecular weight of 380.38 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxopyrrolidin-2-yl)methyl 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoate is sourced from PubChem (CID 78847508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).