C14H17N3OS — CID 788494
N-(1,3-benzothiazol-2-yl)-2-piperidin-1-ylacetamide (PubChem CID 788494) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-piperidin-1-ylacetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 788494 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-piperidin-1-ylacetamide |
| SMILES | O=C(CN1CCCCC1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H17N3OS/c18-13(10-17-8-4-1-5-9-17)16-14-15-11-6-2-3-7-12(11)19-14/h2-3,6-7H,1,4-5,8-10H2,(H,15,16,18) |
| InChIKey | OMEJXRXXPJVIEM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |