C14H20ClNOS2 — CID 78850861
3-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-cyclohexylpropanamide (PubChem CID 78850861) has the molecular formula C14H20ClNOS2 and a molecular weight of 317.91 g/mol. Its IUPAC name is 3-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-cyclohexylpropanamide.
| Compound Name | 3-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 78850861 |
| Molecular Formula | C14H20ClNOS2 |
| Molecular Weight | 317.91 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-cyclohexylpropanamide |
| SMILES | O=C(CCSCc1ccc(Cl)s1)NC1CCCCC1 |
| InChI | InChI=1S/C14H20ClNOS2/c15-13-7-6-12(19-13)10-18-9-8-14(17)16-11-4-2-1-3-5-11/h6-7,11H,1-5,8-10H2,(H,16,17) |
| InChIKey | ZMAGKZMXABWPMS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.91 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|