C21H17ClN6O2 — CID 78851191
(Z)-N-[(6-chloro-3-pyridinyl)methyl]-3-(furan-2-yl)-N-methyl-2-(5-phenyltetrazol-1-yl)prop-2-enamide (PubChem CID 78851191) has the molecular formula C21H17ClN6O2 and a molecular weight of 420.86 g/mol. Its IUPAC name is (Z)-N-[(6-chloro-3-pyridinyl)methyl]-3-(furan-2-yl)-N-methyl-2-(5-phenyltetrazol-1-yl)prop-2-enamide.
| Compound Name | (Z)-N-[(6-chloro-3-pyridinyl)methyl]-3-(furan-2-yl)-N-methyl-2-(5-phenyltetrazol-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 78851191 |
| Molecular Formula | C21H17ClN6O2 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (Z)-N-[(6-chloro-3-pyridinyl)methyl]-3-(furan-2-yl)-N-methyl-2-(5-phenyltetrazol-1-yl)prop-2-enamide |
| SMILES | CN(Cc1ccc(Cl)nc1)C(=O)/C(=C/c1ccco1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C21H17ClN6O2/c1-27(14-15-9-10-19(22)23-13-15)21(29)18(12-17-8-5-11-30-17)28-20(24-25-26-28)16-6-3-2-4-7-16/h2-13H,14H2,1H3/b18-12- |
| InChIKey | YHJGDCPGJPULQG-PDGQHHTCSA-N |
| XLogP | 3.64 |
| TPSA | 89.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|