C23H29ClN6O — CID 78851941
N-[(4-chlorophenyl)methyl]-N-pentyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxamide (PubChem CID 78851941) has the molecular formula C23H29ClN6O and a molecular weight of 440.98 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-pentyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-pentyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78851941 |
| Molecular Formula | C23H29ClN6O |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-pentyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxamide |
| SMILES | CCCCCN(Cc1ccc(Cl)cc1)C(=O)C1CCN(c2ccc3nncn3n2)CC1 |
| InChI | InChI=1S/C23H29ClN6O/c1-2-3-4-13-29(16-18-5-7-20(24)8-6-18)23(31)19-11-14-28(15-12-19)22-10-9-21-26-25-17-30(21)27-22/h5-10,17,19H,2-4,11-16H2,1H3 |
| InChIKey | UQDBZMGNJKCWBO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|