C17H17FN4O2 — CID 78854516
1-(4-fluorophenyl)-N-(3-hydroxypropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 78854516) has the molecular formula C17H17FN4O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(3-hydroxypropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(3-hydroxypropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78854516 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(3-hydroxypropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCCCO)c1cnn(-c2ccc(F)cc2)c1-n1cccc1 |
| InChI | InChI=1S/C17H17FN4O2/c18-13-4-6-14(7-5-13)22-17(21-9-1-2-10-21)15(12-20-22)16(24)19-8-3-11-23/h1-2,4-7,9-10,12,23H,3,8,11H2,(H,19,24) |
| InChIKey | SMKQDYKYHWKLHB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|