About N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide
N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 78855099) has the molecular formula C20H23N3O2
and a molecular weight of 337.42 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide |
| PubChem CID | 78855099 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CCN(CCO)C(=O)C1=NN(c2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C20H23N3O2/c1-2-22(13-14-24)20(25)18-15-19(16-9-5-3-6-10-16)23(21-18)17-11-7-4-8-12-17/h3-12,19,24H,2,13-15H2,1H3 |
| InChIKey | RSGKXVQDXVKBSF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide?
The IUPAC name of N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide (CID 78855099) is N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide.
What is the SMILES notation for N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide?
The canonical SMILES for N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide is CCN(CCO)C(=O)C1=NN(c2ccccc2)C(c2ccccc2)C1.
What is the InChIKey of N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide?
The InChIKey is RSGKXVQDXVKBSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O2/c1-2-22(13-14-24)20(25)18-15-19(16-9-5-3-6-10-16)23(21-18)17-11-7-4-8-12-17/h3-12,19,24H,2,13-15H2,1H3.
What are the key properties of N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide?
N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide has a molecular weight of 337.42 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(2-hydroxyethyl)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxamide is sourced from PubChem (CID 78855099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).