C17H22BrN3O2 — CID 78855646
1-(4-bromophenyl)-N-butyl-N-(2-hydroxyethyl)-5-methylpyrazole-4-carboxamide (PubChem CID 78855646) has the molecular formula C17H22BrN3O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-butyl-N-(2-hydroxyethyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-butyl-N-(2-hydroxyethyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78855646 |
| Molecular Formula | C17H22BrN3O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-(4-bromophenyl)-N-butyl-N-(2-hydroxyethyl)-5-methylpyrazole-4-carboxamide |
| SMILES | CCCCN(CCO)C(=O)c1cnn(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C17H22BrN3O2/c1-3-4-9-20(10-11-22)17(23)16-12-19-21(13(16)2)15-7-5-14(18)6-8-15/h5-8,12,22H,3-4,9-11H2,1-2H3 |
| InChIKey | DLIRLXGXZRARAG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |