C23H21F3N2O2 — CID 78856397
[4-[hydroxy(phenyl)methyl]piperidin-1-yl]-[4-(trifluoromethyl)quinolin-3-yl]methanone (PubChem CID 78856397) has the molecular formula C23H21F3N2O2 and a molecular weight of 414.43 g/mol. Its IUPAC name is [4-[hydroxy(phenyl)methyl]piperidin-1-yl]-[4-(trifluoromethyl)quinolin-3-yl]methanone.
| Compound Name | [4-[hydroxy(phenyl)methyl]piperidin-1-yl]-[4-(trifluoromethyl)quinolin-3-yl]methanone |
|---|---|
| PubChem CID | 78856397 |
| Molecular Formula | C23H21F3N2O2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [4-[hydroxy(phenyl)methyl]piperidin-1-yl]-[4-(trifluoromethyl)quinolin-3-yl]methanone |
| SMILES | O=C(c1cnc2ccccc2c1C(F)(F)F)N1CCC(C(O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H21F3N2O2/c24-23(25,26)20-17-8-4-5-9-19(17)27-14-18(20)22(30)28-12-10-16(11-13-28)21(29)15-6-2-1-3-7-15/h1-9,14,16,21,29H,10-13H2 |
| InChIKey | WIYOOAJTDUUJKZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |