C16H22N2O5 — CID 7885655
[(2S)-1-amino-1-oxopropan-2-yl] 2-[(4-butoxybenzoyl)amino]acetate (PubChem CID 7885655) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-[(4-butoxybenzoyl)amino]acetate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-[(4-butoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7885655 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-[(4-butoxybenzoyl)amino]acetate |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)O[C@@H](C)C(N)=O)cc1 |
| InChI | InChI=1S/C16H22N2O5/c1-3-4-9-22-13-7-5-12(6-8-13)16(21)18-10-14(19)23-11(2)15(17)20/h5-8,11H,3-4,9-10H2,1-2H3,(H2,17,20)(H,18,21)/t11-/m0/s1 |
| InChIKey | MPFFCIZEUMMWSV-NSHDSACASA-N |
| XLogP | 1.01 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|