C12H15NO4 — CID 78857241
methyl 4-(1-hydroxypropan-2-ylcarbamoyl)benzoate (PubChem CID 78857241) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is methyl 4-(1-hydroxypropan-2-ylcarbamoyl)benzoate.
| Compound Name | methyl 4-(1-hydroxypropan-2-ylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 78857241 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | methyl 4-(1-hydroxypropan-2-ylcarbamoyl)benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NC(C)CO)cc1 |
| InChI | InChI=1S/C12H15NO4/c1-8(7-14)13-11(15)9-3-5-10(6-4-9)12(16)17-2/h3-6,8,14H,7H2,1-2H3,(H,13,15) |
| InChIKey | UUMZDGSSKBYXEI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |