C13H18N6O2 — CID 78858358
N,N'-bis(4-methoxypyrimidin-2-yl)propane-1,3-diamine (PubChem CID 78858358) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is N,N'-bis(4-methoxypyrimidin-2-yl)propane-1,3-diamine.
| Compound Name | N,N'-bis(4-methoxypyrimidin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 78858358 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N,N'-bis(4-methoxypyrimidin-2-yl)propane-1,3-diamine |
| SMILES | COc1ccnc(NCCCNc2nccc(OC)n2)n1 |
| InChI | InChI=1S/C13H18N6O2/c1-20-10-4-8-16-12(18-10)14-6-3-7-15-13-17-9-5-11(19-13)21-2/h4-5,8-9H,3,6-7H2,1-2H3,(H,14,16,18)(H,15,17,19) |
| InChIKey | QYXMTBJQFCFVMR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|